Anthranilic acid isobutyl
isobutyl anthranilate
CAS: 7779-77-3
Molecular Formula: C11H15NO2
Anthranilic acid isobutyl - Names and Identifiers
| Name | isobutyl anthranilate |
| Synonyms | FEMA 2182 ISOBUTYL ANTHRANILATE isobutyl anthranilate Isobutyl 2-aminobenzoate Anthranilic acid isobutyl isobutylb10361anthranilate 2-methylpropyl 2-aminobenzoate 2-Methylpropyl 2-aminobenzoate 2-amino-benzoicaci2-methylpropylester Benzoicacid,2-amino-,2-methylpropylester 2-amino-benzoic acid 2-methylpropyl ester Benzoic acid, 2-amino-, 2-methylpropyl ester |
| CAS | 7779-77-3 |
| EINECS | 231-938-0 |
| InChI | InChI=1/C11H15NO2/c1-8(2)7-14-11(13)9-5-3-4-6-10(9)12/h3-6,8H,7,12H2,1-2H3 |
Anthranilic acid isobutyl - Physico-chemical Properties
| Molecular Formula | C11H15NO2 |
| Molar Mass | 193.24 |
| Density | 1,06 g/cm3 |
| Boling Point | 118 °C |
| Flash Point | 147.9°C |
| JECFA Number | 1537 |
| Vapor Presure | 0.00206mmHg at 25°C |
| Stability | Stable, but air and light sensitive. Combustible. Hydrolyses under acidic or basic conditions. |
| Refractive Index | 1.537 |
Anthranilic acid isobutyl - Risk and Safety
| Hazard Symbols | Xi - Irritant |
| Hazard Class | IRRITANT |
Anthranilic acid isobutyl - Reference Information
| FEMA | 2182 | ISOBUTYL ANTHRANILATE |
| NIST chemical information | information provided by: webbook.nist.gov (external link) |
| EPA chemical substance information | information is provided by: ofmpeb.epa.gov (external link) |
Last Update：2024-04-09 19:05:15
